CAS 214852-44-5 appears in our catalog under these names: Fmoc-D-Arg-OH hydrochloride, 98%, Nα–Fmoc–D–arginine Hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 5g, 1g.
(2R)-5-(diaminomethylideneamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid;hydrochloride (CAS 214852-44-5) is a chemical compound with the molecular formula C21H25ClN4O4 and a molecular weight of 432.9 g/mol. IUPAC name: (2R)-5-(diaminomethylideneamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid;hydrochloride. InChIKey: GKVPGWVXDVZUBA-GMUIIQOCSA-N.
| Molecular formula | C21H25ClN4O4 |
|---|---|
| Molecular weight | 432.9 g/mol |
| IUPAC name | (2R)-5-(diaminomethylideneamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid;hydrochloride |
| InChIKey | GKVPGWVXDVZUBA-GMUIIQOCSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCCN=C(N)N)C(=O)O.Cl |
Computed by PubChem (NCBI)