Products 3034673-37-2
CAS 3034673-37-2 is the registry number for SON38. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[2-(4-benzylpiperazin-1-yl)ethyl]-2-(4-chloro-2-nitrophenoxy)acetamide (CAS 3034673-37-2) is a chemical compound with the molecular formula C21H25ClN4O4 and a molecular weight of 432.9 g/mol. IUPAC name: N-[2-(4-benzylpiperazin-1-yl)ethyl]-2-(4-chloro-2-nitrophenoxy)acetamide. InChIKey: DIPUHFMEXYWVPD-UHFFFAOYSA-N.
| Molecular formula | C21H25ClN4O4 |
|---|---|
| Molecular weight | 432.9 g/mol |
| IUPAC name | N-[2-(4-benzylpiperazin-1-yl)ethyl]-2-(4-chloro-2-nitrophenoxy)acetamide |
| InChIKey | DIPUHFMEXYWVPD-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCNC(=O)COC2=C(C=C(C=C2)Cl)[N+](=O)[O-])CC3=CC=CC=C3 |
Computed by PubChem (NCBI)