Products 131685-11-5
CAS 131685-11-5 appears in our catalog under these names: Acetylcysteine-d3, N-Acetyl-L-cysteine-d3, >95% (HPLC), Acetylcysteine–d3, Acetylcysteine-d3, 97.02%. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 50mg, 5mg, 1mg, 5 mg.
(2R)-3-sulfanyl-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid (CAS 131685-11-5) is a chemical compound with the molecular formula C5H9NO3S and a molecular weight of 166.22 g/mol. IUPAC name: (2R)-3-sulfanyl-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid. InChIKey: PWKSKIMOESPYIA-OSIBIXDNSA-N.
| Molecular formula | C5H9NO3S |
|---|---|
| Molecular weight | 166.22 g/mol |
| IUPAC name | (2R)-3-sulfanyl-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid |
| InChIKey | PWKSKIMOESPYIA-OSIBIXDNSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)N[C@@H](CS)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(2R)-3-sulfanyl-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid, (2R)-3-sulfanyl-2-((2,2,2-trideuterioacetyl)amino)propanoic acid, N-Acetyl-L-cysteine-d3, Acetylcysteine-d3, N-Acetyl-d3-L-cysteine, L-Cysteine, N-(acetyl-d3)- (9CI), N-Acetylcysteine-d3, (acetyl-d3)-L-cysteine, N-trideuteroacetyl-l-cysteine, orb3138842