CAS 131773-47-2 is the registry number for 2,6,7–TRICHLOROIMIDAZO(1,2–A)PYRIDINE. Offered by: GLPBio. Available pack sizes: 1g.
2,6,7-trichloroimidazo[1,2-a]pyridine (CAS 131773-47-2) is a chemical compound with the molecular formula C7H3Cl3N2 and a molecular weight of 221.5 g/mol. IUPAC name: 2,6,7-trichloroimidazo[1,2-a]pyridine. InChIKey: XBXKPYCRNDDSEE-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl3N2 |
|---|---|
| Molecular weight | 221.5 g/mol |
| IUPAC name | 2,6,7-trichloroimidazo[1,2-a]pyridine |
| InChIKey | XBXKPYCRNDDSEE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN2C1=NC(=C2)Cl)Cl)Cl |
Computed by PubChem (NCBI)