Products 63195-39-1
CAS 63195-39-1 is the registry number for 2,5,6-Trichloro-4-methyl-3-pyridinecarbonitrile, 95%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
2,5,6-trichloro-4-methylpyridine-3-carbonitrile (CAS 63195-39-1) is a chemical compound with the molecular formula C7H3Cl3N2 and a molecular weight of 221.5 g/mol. IUPAC name: 2,5,6-trichloro-4-methylpyridine-3-carbonitrile. InChIKey: MEICKJSSGQUWTE-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl3N2 |
|---|---|
| Molecular weight | 221.5 g/mol |
| IUPAC name | 2,5,6-trichloro-4-methylpyridine-3-carbonitrile |
| InChIKey | MEICKJSSGQUWTE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=C1Cl)Cl)Cl)C#N |
Computed by PubChem (NCBI)