Products 2452251-85-1
CAS 2452251-85-1 is the registry number for 3,4,6-Trichloro-1H-pyrrolo[2,3-b]pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3,4,6-trichloro-1H-pyrrolo[2,3-b]pyridine (CAS 2452251-85-1) is a chemical compound with the molecular formula C7H3Cl3N2 and a molecular weight of 221.5 g/mol. IUPAC name: 3,4,6-trichloro-1H-pyrrolo[2,3-b]pyridine. InChIKey: MCLUUEDWLCOLRU-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl3N2 |
|---|---|
| Molecular weight | 221.5 g/mol |
| IUPAC name | 3,4,6-trichloro-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | MCLUUEDWLCOLRU-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(NC=C2Cl)N=C1Cl)Cl |
Computed by PubChem (NCBI)