Products 13182-81-5

CAS 13182-81-5 is the registry number for 1-(2-Chloroethyl)-2-methyl-5-nitroimidazole. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 1g, 500mg.

Structural formula: {0} (CAS {1})

1-(2-chloroethyl)-2-methyl-5-nitroimidazole (CAS 13182-81-5) is a chemical compound with the molecular formula C6H8ClN3O2 and a molecular weight of 189.60 g/mol. IUPAC name: 1-(2-chloroethyl)-2-methyl-5-nitroimidazole. InChIKey: FSFWMJBQLWFXSM-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8ClN3O2
Molecular weight189.60 g/mol
IUPAC name1-(2-chloroethyl)-2-methyl-5-nitroimidazole
InChIKeyFSFWMJBQLWFXSM-UHFFFAOYSA-N
SMILESCC1=NC=C(N1CCCl)[N+](=O)[O-]

Computed by PubChem (NCBI)