CAS 13182-81-5 is the registry number for 1-(2-Chloroethyl)-2-methyl-5-nitroimidazole. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 1g, 500mg.
1-(2-chloroethyl)-2-methyl-5-nitroimidazole (CAS 13182-81-5) is a chemical compound with the molecular formula C6H8ClN3O2 and a molecular weight of 189.60 g/mol. IUPAC name: 1-(2-chloroethyl)-2-methyl-5-nitroimidazole. InChIKey: FSFWMJBQLWFXSM-UHFFFAOYSA-N.
| Molecular formula | C6H8ClN3O2 |
|---|---|
| Molecular weight | 189.60 g/mol |
| IUPAC name | 1-(2-chloroethyl)-2-methyl-5-nitroimidazole |
| InChIKey | FSFWMJBQLWFXSM-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(N1CCCl)[N+](=O)[O-] |
Computed by PubChem (NCBI)