CAS 2302-28-5 appears in our catalog under these names: 5-chloro-1-ethyl-2-methyl-4-nitro-1h-imidazole, 95%, 5-Chloro-1-ethyl-2-methyl-4-nitro-1H-imidazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
5-chloro-1-ethyl-2-methyl-4-nitroimidazole (CAS 2302-28-5) is a chemical compound with the molecular formula C6H8ClN3O2 and a molecular weight of 189.60 g/mol. IUPAC name: 5-chloro-1-ethyl-2-methyl-4-nitroimidazole. InChIKey: MVICIJDNZUMTFU-UHFFFAOYSA-N.
| Molecular formula | C6H8ClN3O2 |
|---|---|
| Molecular weight | 189.60 g/mol |
| IUPAC name | 5-chloro-1-ethyl-2-methyl-4-nitroimidazole |
| InChIKey | MVICIJDNZUMTFU-UHFFFAOYSA-N |
| SMILES | CCN1C(=NC(=C1Cl)[N+](=O)[O-])C |
Computed by PubChem (NCBI)