Products 1423031-46-2

CAS 1423031-46-2 is the registry number for 6-Hydrazinylpyridine-3-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

6-hydrazinylpyridine-3-carboxylic acid;hydrochloride (CAS 1423031-46-2) is a chemical compound with the molecular formula C6H8ClN3O2 and a molecular weight of 189.60 g/mol. IUPAC name: 6-hydrazinylpyridine-3-carboxylic acid;hydrochloride. InChIKey: ITPDZLBALZCKIB-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8ClN3O2
Molecular weight189.60 g/mol
IUPAC name6-hydrazinylpyridine-3-carboxylic acid;hydrochloride
InChIKeyITPDZLBALZCKIB-UHFFFAOYSA-N
SMILESC1=CC(=NC=C1C(=O)O)NN.Cl

Computed by PubChem (NCBI)