Products 131821-81-3

CAS 131821-81-3 is the registry number for N-Despropionyl N-Acetyl Carfentanil Methyl Ester. Offered by: TRC. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Methyl 4-(N-acetylanilino)-1-(2-phenylethyl)piperidine-4-carboxylate (CAS 131821-81-3) is a chemical compound with the molecular formula C23H28N2O3 and a molecular weight of 380.5 g/mol. IUPAC name: methyl 4-(N-acetylanilino)-1-(2-phenylethyl)piperidine-4-carboxylate. InChIKey: KDWNFIZTOZPRAD-UHFFFAOYSA-N.

Identity
Molecular formulaC23H28N2O3
Molecular weight380.5 g/mol
IUPAC namemethyl 4-(N-acetylanilino)-1-(2-phenylethyl)piperidine-4-carboxylate
InChIKeyKDWNFIZTOZPRAD-UHFFFAOYSA-N
SMILESCC(=O)N(C1=CC=CC=C1)C2(CCN(CC2)CCC3=CC=CC=C3)C(=O)OC

Computed by PubChem (NCBI)