Products 61085-72-1

CAS 61085-72-1 is the registry number for Remifentanil Impurity 6 (Remifentanil EP Impurity G). Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

Methyl 1-benzyl-4-(N-propanoylanilino)piperidine-4-carboxylate (CAS 61085-72-1) is a chemical compound with the molecular formula C23H28N2O3 and a molecular weight of 380.5 g/mol. IUPAC name: methyl 1-benzyl-4-(N-propanoylanilino)piperidine-4-carboxylate. InChIKey: QKRGHVDSVANHAD-UHFFFAOYSA-N.

Identity
Molecular formulaC23H28N2O3
Molecular weight380.5 g/mol
IUPAC namemethyl 1-benzyl-4-(N-propanoylanilino)piperidine-4-carboxylate
InChIKeyQKRGHVDSVANHAD-UHFFFAOYSA-N
SMILESCCC(=O)N(C1=CC=CC=C1)C2(CCN(CC2)CC3=CC=CC=C3)C(=O)OC

Computed by PubChem (NCBI)