CAS 13188-89-1 appears in our catalog under these names: H–D–Asp(OBzl)–OH, H-D-Asp(OBzl)-OH 97%, H-D-Asp(Obzl)-Oh, 97%, 97%, H-D-Asp(OBzl)-OH, 96%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 500g, 1g, 10g, 100g.
(2R)-2-amino-4-oxo-4-phenylmethoxybutanoic acid (CAS 13188-89-1) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: (2R)-2-amino-4-oxo-4-phenylmethoxybutanoic acid. InChIKey: VGALFAWDSNRXJK-SECBINFHSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | (2R)-2-amino-4-oxo-4-phenylmethoxybutanoic acid |
| InChIKey | VGALFAWDSNRXJK-SECBINFHSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)