Products 63228-51-3
CAS 63228-51-3 is the registry number for Methyl 2-hydroxyquinoline-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
2-amino-4-oxo-4-phenylmethoxybutanoic acid (CAS 63228-51-3) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: 2-amino-4-oxo-4-phenylmethoxybutanoic acid. InChIKey: VGALFAWDSNRXJK-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | 2-amino-4-oxo-4-phenylmethoxybutanoic acid |
| InChIKey | VGALFAWDSNRXJK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CC(C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
2-amino-4-(benzyloxy)-4-oxobutanoic acid, 2-amino-4-oxo-4-phenylmethoxybutanoic acid, D-Aspartic acid beta-benzyl ester, L-Aspartic acid b-benzyl ester, L-Aspartic acid, 4-(phenylmethyl) ester, 2-amino-4-benzyloxy-4-oxo-butanoic acid, beta-benzyl-D-aspartate, .beta.-Benzyl L-aspartate, .beta.-l-Benzyl aspartate, D-Aspartic acid b-benzyl ester