Products 131888-14-7
CAS 131888-14-7 is the registry number for 2-Propen-1-one, 1-(4-aminophenyl)-3-(4-methoxyphenyl)-, (2E)-, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(E)-1-(4-aminophenyl)-3-(4-methoxyphenyl)prop-2-en-1-one (CAS 131888-14-7) is a chemical compound with the molecular formula C16H15NO2 and a molecular weight of 253.29 g/mol. IUPAC name: (E)-1-(4-aminophenyl)-3-(4-methoxyphenyl)prop-2-en-1-one. InChIKey: QIFZZXZSSXRDOT-NYYWCZLTSA-N.
| Molecular formula | C16H15NO2 |
|---|---|
| Molecular weight | 253.29 g/mol |
| IUPAC name | (E)-1-(4-aminophenyl)-3-(4-methoxyphenyl)prop-2-en-1-one |
| InChIKey | QIFZZXZSSXRDOT-NYYWCZLTSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C/C(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)