CAS 13189-17-8 is the registry number for 2,​3-Ddihydro-​2,​2-​dimethyl-4H-​1-​benzothiopyran-​4-​one 1-​oxide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,2-dimethyl-1-oxo-3H-thiochromen-4-one (CAS 13189-17-8) is a chemical compound with the molecular formula C11H12O2S and a molecular weight of 208.28 g/mol. IUPAC name: 2,2-dimethyl-1-oxo-3H-thiochromen-4-one. InChIKey: WOOJHNTVFKIULA-UHFFFAOYSA-N.
| Molecular formula | C11H12O2S |
|---|---|
| Molecular weight | 208.28 g/mol |
| IUPAC name | 2,2-dimethyl-1-oxo-3H-thiochromen-4-one |
| InChIKey | WOOJHNTVFKIULA-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=CC=CC=C2S1=O)C |
Computed by PubChem (NCBI)