CAS 131918-95-1 is the registry number for 9-Demethoxyethanol-9-propanol Isoacyclovir. Offered by: TRC. Available pack sizes: 50mg.
2-amino-7-(3-hydroxypropyl)-1H-purin-6-one (CAS 131918-95-1) is a chemical compound with the molecular formula C8H11N5O2 and a molecular weight of 209.21 g/mol. IUPAC name: 2-amino-7-(3-hydroxypropyl)-1H-purin-6-one. InChIKey: ZXQLCYBGQKPABN-UHFFFAOYSA-N.
| Molecular formula | C8H11N5O2 |
|---|---|
| Molecular weight | 209.21 g/mol |
| IUPAC name | 2-amino-7-(3-hydroxypropyl)-1H-purin-6-one |
| InChIKey | ZXQLCYBGQKPABN-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1CCCO)C(=O)NC(=N2)N |
Computed by PubChem (NCBI)