CAS 1346599-30-1 appears in our catalog under these names: 7-(2-Hydroxy(propyl-d6))guanine, 7-[2-Hydroxy(propyl-d6)]guanine. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 25 mg, 2.5 mg.
2-amino-7-(1,1,2,3,3,3-hexadeuterio-2-hydroxypropyl)-1H-purin-6-one (CAS 1346599-30-1) is a chemical compound with the molecular formula C8H11N5O2 and a molecular weight of 215.24 g/mol. IUPAC name: 2-amino-7-(1,1,2,3,3,3-hexadeuterio-2-hydroxypropyl)-1H-purin-6-one. InChIKey: JVWVMKYNORDKGP-DEGIAHCOSA-N.
| Molecular formula | C8H11N5O2 |
|---|---|
| Molecular weight | 215.24 g/mol |
| IUPAC name | 2-amino-7-(1,1,2,3,3,3-hexadeuterio-2-hydroxypropyl)-1H-purin-6-one |
| InChIKey | JVWVMKYNORDKGP-DEGIAHCOSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])N1C=NC2=C1C(=O)NC(=N2)N)O |
Computed by PubChem (NCBI)