CAS 1346603-33-5 is the registry number for 7-(1-Methyl-2-hydroxyethyl)guanine, >95% (HPLC). Offered by: TRC. Available pack sizes: 25mg, 50mg, 5mg.
2-amino-7-(1-hydroxypropan-2-yl)-1H-purin-6-one (CAS 1346603-33-5) is a chemical compound with the molecular formula C8H11N5O2 and a molecular weight of 209.21 g/mol. IUPAC name: 2-amino-7-(1-hydroxypropan-2-yl)-1H-purin-6-one. InChIKey: NOXOALKZIYCNRV-UHFFFAOYSA-N.
| Molecular formula | C8H11N5O2 |
|---|---|
| Molecular weight | 209.21 g/mol |
| IUPAC name | 2-amino-7-(1-hydroxypropan-2-yl)-1H-purin-6-one |
| InChIKey | NOXOALKZIYCNRV-UHFFFAOYSA-N |
| SMILES | CC(CO)N1C=NC2=C1C(=O)NC(=N2)N |
Computed by PubChem (NCBI)