Products 1319257-87-8

CAS 1319257-87-8 is the registry number for Ribavirin Impurity 27. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 3-methoxy-1H-1,2,4-triazole-5-carboxylate (CAS 1319257-87-8) is a chemical compound with the molecular formula C5H7N3O3 and a molecular weight of 157.13 g/mol. IUPAC name: methyl 3-methoxy-1H-1,2,4-triazole-5-carboxylate. InChIKey: WSWKMXHPIXKKBX-UHFFFAOYSA-N.

Identity
Molecular formulaC5H7N3O3
Molecular weight157.13 g/mol
IUPAC namemethyl 3-methoxy-1H-1,2,4-triazole-5-carboxylate
InChIKeyWSWKMXHPIXKKBX-UHFFFAOYSA-N
SMILESCOC1=NNC(=N1)C(=O)OC

Computed by PubChem (NCBI)