Products 131926-98-2
CAS 131926-98-2 appears in our catalog under these names: 5-Hydroxy Lansoprazole, 5–Hydroxylansoprazole, 5-Hydroxylansoprazole, 99.00% ,, 99.00% ,, 5-Hydroxylansoprazole, 99.0%, Lansoprazole Impurity G(5-Hydroxy Lansoprazole). Offered by: Chemat Brand, GLPBio, Chemat, MedChemExpress. Available pack sizes: on request, 1mg, 10mg, 5mg, 2mg, 5 mg, 10 mg.
2-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfinyl]-3H-benzimidazol-5-ol (CAS 131926-98-2) is a chemical compound with the molecular formula C16H14F3N3O3S and a molecular weight of 385.4 g/mol. IUPAC name: 2-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfinyl]-3H-benzimidazol-5-ol. InChIKey: IDCLTMRSSAXUNY-UHFFFAOYSA-N.
| Molecular formula | C16H14F3N3O3S |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | 2-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfinyl]-3H-benzimidazol-5-ol |
| InChIKey | IDCLTMRSSAXUNY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CN=C1CS(=O)C2=NC3=C(N2)C=C(C=C3)O)OCC(F)(F)F |
Computed by PubChem (NCBI)