CAS 916888-64-7 is the registry number for 2-(4-(2-(Trifluoromethyl)benzoyl)piperazin-1-yl)thiazole-5-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-1,3-thiazole-5-carboxylic acid (CAS 916888-64-7) is a chemical compound with the molecular formula C16H14F3N3O3S and a molecular weight of 385.4 g/mol. IUPAC name: 2-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-1,3-thiazole-5-carboxylic acid. InChIKey: PHZDRQUKVAZUCA-UHFFFAOYSA-N.
| Molecular formula | C16H14F3N3O3S |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | 2-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-1,3-thiazole-5-carboxylic acid |
| InChIKey | PHZDRQUKVAZUCA-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=NC=C(S2)C(=O)O)C(=O)C3=CC=CC=C3C(F)(F)F |
Computed by PubChem (NCBI)