CAS 131926-99-3 appears in our catalog under these names: Lansoprazole sulfone, 95%, Lansoprazole EP Impurity B (Lansoprazole Sulfone), Lansoprazole Impurity B(EP), Lansoprazole Sulfone, >95% (HPLC), 2-(((3-Methyl-4-(2,2,2-trifluoroethoxy)pyridin-2-yl)methyl)sulphonyl)-1H-benzimidazole (Lansoprazole Sulphone). Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, TargetMol. Available pack sizes: 100mg, 250mg, on request, 10mg, 25mg, 1mg, 5mg, 50mg.
2-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfonyl]-1H-benzimidazole (CAS 131926-99-3) is a chemical compound with the molecular formula C16H14F3N3O3S and a molecular weight of 385.4 g/mol. IUPAC name: 2-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfonyl]-1H-benzimidazole. InChIKey: TVMJMCGRSSSSDJ-UHFFFAOYSA-N.
| Molecular formula | C16H14F3N3O3S |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | 2-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfonyl]-1H-benzimidazole |
| InChIKey | TVMJMCGRSSSSDJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CN=C1CS(=O)(=O)C2=NC3=CC=CC=C3N2)OCC(F)(F)F |
Computed by PubChem (NCBI)