CAS 131968-74-6 appears in our catalog under these names: (2R,3S)-3-Phenylisoserine methyl ester, 95%, 95%, rel-(2R,3S)-3-Phenylisoserine methyl ester, 99.12%, (2R,3S)-3-phenylisoserine methyl ester, 95%. Offered by: Chemat, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 25 mg, 100 mg, 1 g, 500 mg.
Methyl (2R,3S)-3-amino-2-hydroxy-3-phenylpropanoate (CAS 131968-74-6) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: methyl (2R,3S)-3-amino-2-hydroxy-3-phenylpropanoate. InChIKey: WZPZWAQKLOPJEL-DTWKUNHWSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | methyl (2R,3S)-3-amino-2-hydroxy-3-phenylpropanoate |
| InChIKey | WZPZWAQKLOPJEL-DTWKUNHWSA-N |
| SMILES | COC(=O)[C@@H]([C@H](C1=CC=CC=C1)N)O |
Computed by PubChem (NCBI)