CAS 157722-44-6 is the registry number for Benzenepropanoic acid, beta-amino-alpha-hydroxy-, methyl ester, (alphar,betar)-, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl (2R,3R)-3-amino-2-hydroxy-3-phenylpropanoate (CAS 157722-44-6) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: methyl (2R,3R)-3-amino-2-hydroxy-3-phenylpropanoate. InChIKey: WZPZWAQKLOPJEL-RKDXNWHRSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | methyl (2R,3R)-3-amino-2-hydroxy-3-phenylpropanoate |
| InChIKey | WZPZWAQKLOPJEL-RKDXNWHRSA-N |
| SMILES | COC(=O)[C@@H]([C@@H](C1=CC=CC=C1)N)O |
Computed by PubChem (NCBI)