CAS 1319743-56-0 is the registry number for 6-Chloro-3,3-dimethyl-2,3-dihydro-1H-indol-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-chloro-3,3-dimethyl-1H-indol-2-one (CAS 1319743-56-0) is a chemical compound with the molecular formula C10H10ClNO and a molecular weight of 195.64 g/mol. IUPAC name: 6-chloro-3,3-dimethyl-1H-indol-2-one. InChIKey: DOVDLTAYFCBHAN-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO |
|---|---|
| Molecular weight | 195.64 g/mol |
| IUPAC name | 6-chloro-3,3-dimethyl-1H-indol-2-one |
| InChIKey | DOVDLTAYFCBHAN-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)Cl)NC1=O)C |
Computed by PubChem (NCBI)