CAS 132-31-0 appears in our catalog under these names: Indophenol blue, 95%, 4-((4-(Dimethylamino)phenyl)imino)naphthalen-1(4H)-one, 97%, Indophenol Blue, Indophenol Blue, 4-((4-(Dimethylamino)phenyl)imino)naphthalen-1(4H)-one. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Sigma-Aldrich. Available pack sizes: 250mg, 1g, 10g, 5g.
4-[4-(dimethylamino)phenyl]iminonaphthalen-1-one (CAS 132-31-0) is a chemical compound with the molecular formula C18H16N2O and a molecular weight of 276.3 g/mol. IUPAC name: 4-[4-(dimethylamino)phenyl]iminonaphthalen-1-one. InChIKey: VRZJGENLTNRAIG-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O |
|---|---|
| Molecular weight | 276.3 g/mol |
| IUPAC name | 4-[4-(dimethylamino)phenyl]iminonaphthalen-1-one |
| InChIKey | VRZJGENLTNRAIG-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)N=C2C=CC(=O)C3=CC=CC=C23 |
Computed by PubChem (NCBI)