Products 941083-76-7
CAS 941083-76-7 appears in our catalog under these names: 4'-[(2-Oxopyrrolidin-1-yl)methyl]-1,1'-biphenyl-2-carbonitrile, 95%, 2-{4-((2-oxopyrrolidin-1-yl)methyl)phenyl}benzonitrile, 95%, 2-{4-((2-Oxopyrrolidin-1-yl)methyl)phenyl}benzonitrile. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]benzonitrile (CAS 941083-76-7) is a chemical compound with the molecular formula C18H16N2O and a molecular weight of 276.3 g/mol. IUPAC name: 2-[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]benzonitrile. InChIKey: CFZQSGWUWLNOLG-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O |
|---|---|
| Molecular weight | 276.3 g/mol |
| IUPAC name | 2-[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]benzonitrile |
| InChIKey | CFZQSGWUWLNOLG-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)CC2=CC=C(C=C2)C3=CC=CC=C3C#N |
Computed by PubChem (NCBI)