CAS 74300-17-7 is the registry number for 2,3,4,9-Tetrahydro-2-methyl-9-phenyl-1H-pyrido(3,4-b)indol-1-one. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-9-phenyl-3,4-dihydropyrido[3,4-b]indol-1-one (CAS 74300-17-7) is a chemical compound with the molecular formula C18H16N2O and a molecular weight of 276.3 g/mol. IUPAC name: 2-methyl-9-phenyl-3,4-dihydropyrido[3,4-b]indol-1-one. InChIKey: SDXXOAKMAHOTRB-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O |
|---|---|
| Molecular weight | 276.3 g/mol |
| IUPAC name | 2-methyl-9-phenyl-3,4-dihydropyrido[3,4-b]indol-1-one |
| InChIKey | SDXXOAKMAHOTRB-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C(C1=O)N(C3=CC=CC=C23)C4=CC=CC=C4 |
Computed by PubChem (NCBI)