Products 13211-37-5
CAS 13211-37-5 appears in our catalog under these names: Z–Ile–Pro–OH, Z-Ile-Pro-OH, Cbz-Ile-Pro-OH. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5g, 1g, 500mg, 1000mg, 2000mg, 10000mg, 5000mg, Get quote.
(2S)-1-[(2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]pyrrolidine-2-carboxylic acid (CAS 13211-37-5) is a chemical compound with the molecular formula C19H26N2O5 and a molecular weight of 362.4 g/mol. IUPAC name: (2S)-1-[(2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]pyrrolidine-2-carboxylic acid. InChIKey: ABVHKUUPJNVPLM-BPUTZDHNSA-N.
| Molecular formula | C19H26N2O5 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | (2S)-1-[(2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | ABVHKUUPJNVPLM-BPUTZDHNSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)N1CCC[C@H]1C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)