CAS 52071-65-5 appears in our catalog under these names: Boc–Pro–Phe–OH, Boc-Pro-Phe-OH, 98%, Boc-Pro-Phe-OH, Boc-Pro-Phe-OH 98%, BOC-PRO-PHE-OH, 95%, 95%. Offered by: GLPBio, Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 25g, 2g, 100mg, 250mg.
(2S)-2-[[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoic acid (CAS 52071-65-5) is a chemical compound with the molecular formula C19H26N2O5 and a molecular weight of 362.4 g/mol. IUPAC name: (2S)-2-[[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoic acid. InChIKey: JYOQCCFYSJPSLC-GJZGRUSLSA-N.
| Molecular formula | C19H26N2O5 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | (2S)-2-[[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoic acid |
| InChIKey | JYOQCCFYSJPSLC-GJZGRUSLSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)