Products 1634-90-8
CAS 1634-90-8 appears in our catalog under these names: Z–Pro–Leu–OH, Z-Pro-Leu-OH. Offered by: GLPBio, Biosynth. Available pack sizes: 25g, 5g, 10g, 50g.
(2S)-4-methyl-2-[[(2S)-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]amino]pentanoic acid (CAS 1634-90-8) is a chemical compound with the molecular formula C19H26N2O5 and a molecular weight of 362.4 g/mol. IUPAC name: (2S)-4-methyl-2-[[(2S)-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]amino]pentanoic acid. InChIKey: YCYXUKRYYSXSLJ-HOTGVXAUSA-N.
| Molecular formula | C19H26N2O5 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | (2S)-4-methyl-2-[[(2S)-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]amino]pentanoic acid |
| InChIKey | YCYXUKRYYSXSLJ-HOTGVXAUSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)[C@@H]1CCCN1C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)