CAS 132119-11-0 appears in our catalog under these names: Mebendazole EP Impurity D, 1-Methyl Mebendazole, >95% (HPLC), Methyl (5-Benzoyl-1-methyl-1H-benzimidazol-2-yl)carbamate, Mebendazole impurity 3. Offered by: Chemat Brand, TRC, Mikromol, MedChemExpress. Available pack sizes: on request, 100mg, 10mg, 50mg, Get quote.
Methyl N-(5-benzoyl-1-methylbenzimidazol-2-yl)carbamate (CAS 132119-11-0) is a chemical compound with the molecular formula C17H15N3O3 and a molecular weight of 309.32 g/mol. IUPAC name: methyl N-(5-benzoyl-1-methylbenzimidazol-2-yl)carbamate. InChIKey: KXXOKPYARUONDX-UHFFFAOYSA-N.
| Molecular formula | C17H15N3O3 |
|---|---|
| Molecular weight | 309.32 g/mol |
| IUPAC name | methyl N-(5-benzoyl-1-methylbenzimidazol-2-yl)carbamate |
| InChIKey | KXXOKPYARUONDX-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)C(=O)C3=CC=CC=C3)N=C1NC(=O)OC |
Computed by PubChem (NCBI)