CAS 27031-00-1 appears in our catalog under these names: iGP–1, iGP-1 95%, iGP-1, 99.43%, IGP-1/ 99.52% (existing batch purity), 4-([4-(1H-Benzimidazol-2-yl)phenyl]amino)-4-oxobutanoic acid, 95%. Offered by: GLPBio, Ambeed, MedChemExpress, TargetMol, Combi-blocks. Available pack sizes: 5mg, 100mg, 250mg, 1g, 10 mg, 10mM/1mL, 50 mg, 5 mg.
4-[4-(1H-benzimidazol-2-yl)anilino]-4-oxobutanoic acid (CAS 27031-00-1) is a chemical compound with the molecular formula C17H15N3O3 and a molecular weight of 309.32 g/mol. IUPAC name: 4-[4-(1H-benzimidazol-2-yl)anilino]-4-oxobutanoic acid. InChIKey: ARVPDCQNTCJVSU-UHFFFAOYSA-N.
| Molecular formula | C17H15N3O3 |
|---|---|
| Molecular weight | 309.32 g/mol |
| IUPAC name | 4-[4-(1H-benzimidazol-2-yl)anilino]-4-oxobutanoic acid |
| InChIKey | ARVPDCQNTCJVSU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)C3=CC=C(C=C3)NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)