CAS 89141-65-1 appears in our catalog under these names: (±)–3–methyl Nimetazepam, 3-Methyl Mimetazepam, (±)-3-Methyl nimetazepam. Offered by: GLPBio, TRC, MedChemExpress. Available pack sizes: 1mg, 50mg, 5mg, 5 mg, 1 mg.
1,3-dimethyl-7-nitro-5-phenyl-3H-1,4-benzodiazepin-2-one (CAS 89141-65-1) is a chemical compound with the molecular formula C17H15N3O3 and a molecular weight of 309.32 g/mol. IUPAC name: 1,3-dimethyl-7-nitro-5-phenyl-3H-1,4-benzodiazepin-2-one. InChIKey: ASEJDTDWRXVAHE-UHFFFAOYSA-N.
| Molecular formula | C17H15N3O3 |
|---|---|
| Molecular weight | 309.32 g/mol |
| IUPAC name | 1,3-dimethyl-7-nitro-5-phenyl-3H-1,4-benzodiazepin-2-one |
| InChIKey | ASEJDTDWRXVAHE-UHFFFAOYSA-N |
| SMILES | CC1C(=O)N(C2=C(C=C(C=C2)[N+](=O)[O-])C(=N1)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)