CAS 132145-60-9 appears in our catalog under these names: ethyl 2–(4–cyanophenyl)cyclopropane–1–carboxylate, ethyl trans-2-(4-cyanophenyl)cyclopropanecarboxylate, 97%, 97%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 500mg, 5g, 100mg, 250mg.
Trans-ethyl (1R,2R)-2-(4-cyanophenyl)cyclopropane-1-carboxylate (CAS 132145-60-9) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: trans-ethyl (1R,2R)-2-(4-cyanophenyl)cyclopropane-1-carboxylate. InChIKey: QWCIETZJHLAWCB-NWDGAFQWSA-N.
| Molecular formula | C13H13NO2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | trans-ethyl (1R,2R)-2-(4-cyanophenyl)cyclopropane-1-carboxylate |
| InChIKey | QWCIETZJHLAWCB-NWDGAFQWSA-N |
| SMILES | CCOC(=O)[C@@H]1C[C@H]1C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)