CAS 1321518-05-1 appears in our catalog under these names: N,N-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine, 95%, 2-(Dimethylamino)pyridine-4-boronic acid pinacol ester, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (CAS 1321518-05-1) is a chemical compound with the molecular formula C13H21BN2O2 and a molecular weight of 248.13 g/mol. IUPAC name: N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine. InChIKey: QKGTYOKKQHKHQB-UHFFFAOYSA-N.
| Molecular formula | C13H21BN2O2 |
|---|---|
| Molecular weight | 248.13 g/mol |
| IUPAC name | N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| InChIKey | QKGTYOKKQHKHQB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2)N(C)C |
Computed by PubChem (NCBI)