CAS 1820679-54-6 appears in our catalog under these names: 2-(Iso-propyl)pyrimidine-5-boronic acid pinacol ester, 95%, 2-Isopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 10g.
2-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (CAS 1820679-54-6) is a chemical compound with the molecular formula C13H21BN2O2 and a molecular weight of 248.13 g/mol. IUPAC name: 2-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine. InChIKey: BHQPQHXVDKDEKK-UHFFFAOYSA-N.
| Molecular formula | C13H21BN2O2 |
|---|---|
| Molecular weight | 248.13 g/mol |
| IUPAC name | 2-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| InChIKey | BHQPQHXVDKDEKK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)C(C)C |
Computed by PubChem (NCBI)