CAS 1704069-65-7 appears in our catalog under these names: (4-(1-(4-Methylpiperazin-1-yl)ethyl)phenyl)boronic acid, 95%, (4-(1-(4-methylpiperazin-1-yl)ethyl)phenyl)boronic acid, 98+%, (4–(1–(4–Methylpiperazin–1–yl) ethyl)phenyl)boronic acid, (4-(1-(4-methylpiperazin-1-yl)ethyl)phenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
[4-[1-(4-methylpiperazin-1-yl)ethyl]phenyl]boronic acid (CAS 1704069-65-7) is a chemical compound with the molecular formula C13H21BN2O2 and a molecular weight of 248.13 g/mol. IUPAC name: [4-[1-(4-methylpiperazin-1-yl)ethyl]phenyl]boronic acid. InChIKey: GKJJUVULSZUPLG-UHFFFAOYSA-N.
| Molecular formula | C13H21BN2O2 |
|---|---|
| Molecular weight | 248.13 g/mol |
| IUPAC name | [4-[1-(4-methylpiperazin-1-yl)ethyl]phenyl]boronic acid |
| InChIKey | GKJJUVULSZUPLG-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(C)N2CCN(CC2)C)(O)O |
Computed by PubChem (NCBI)