Products 132152-57-9
CAS 132152-57-9 is the registry number for Epi-cryptoacetalide. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, Get quote.
(3R,4'R)-4',6,6-trimethylspiro[8,9-dihydro-7H-benzo[g][2]benzofuran-3,2'-oxolane]-1-one (CAS 132152-57-9) is a chemical compound with the molecular formula C18H22O3 and a molecular weight of 286.4 g/mol. IUPAC name: (3R,4'R)-4',6,6-trimethylspiro[8,9-dihydro-7H-benzo[g][2]benzofuran-3,2'-oxolane]-1-one. InChIKey: HUTQFIYQAWCICW-ADLMAVQZSA-N.
| Molecular formula | C18H22O3 |
|---|---|
| Molecular weight | 286.4 g/mol |
| IUPAC name | (3R,4'R)-4',6,6-trimethylspiro[8,9-dihydro-7H-benzo[g][2]benzofuran-3,2'-oxolane]-1-one |
| InChIKey | HUTQFIYQAWCICW-ADLMAVQZSA-N |
| SMILES | C[C@@H]1C[C@@]2(C3=C(C4=C(C=C3)C(CCC4)(C)C)C(=O)O2)OC1 |
Computed by PubChem (NCBI)