Products 1321889-58-0
CAS 1321889-58-0 is the registry number for 1,4-Dimethoxy-1,4-dioxo-3-(quinolin-1-ium-1-yl)but-2-ene-2-thiolate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(Z)-1,4-dimethoxy-1,4-dioxo-3-quinolin-1-ium-1-ylbut-2-ene-2-thiolate (CAS 1321889-58-0) is a chemical compound with the molecular formula C15H13NO4S and a molecular weight of 303.3 g/mol. IUPAC name: (Z)-1,4-dimethoxy-1,4-dioxo-3-quinolin-1-ium-1-ylbut-2-ene-2-thiolate. InChIKey: WRDIACWPHIHBAM-UHFFFAOYSA-N.
| Molecular formula | C15H13NO4S |
|---|---|
| Molecular weight | 303.3 g/mol |
| IUPAC name | (Z)-1,4-dimethoxy-1,4-dioxo-3-quinolin-1-ium-1-ylbut-2-ene-2-thiolate |
| InChIKey | WRDIACWPHIHBAM-UHFFFAOYSA-N |
| SMILES | COC(=O)/C(=C(\C(=O)OC)/[S-])/[N+]1=CC=CC2=CC=CC=C21 |
Computed by PubChem (NCBI)