Products 2130853-04-0
CAS 2130853-04-0 is the registry number for Belinostat Acid-d5. Offered by: Chemat Brand, Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
(E)-3-[3-[(2,3,4,5,6-pentadeuteriophenyl)sulfamoyl]phenyl]prop-2-enoic acid (CAS 2130853-04-0) is a chemical compound with the molecular formula C15H13NO4S and a molecular weight of 308.4 g/mol. IUPAC name: (E)-3-[3-[(2,3,4,5,6-pentadeuteriophenyl)sulfamoyl]phenyl]prop-2-enoic acid. InChIKey: ALGZPROJSRYPIG-HMUIAXRESA-N.
| Molecular formula | C15H13NO4S |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | (E)-3-[3-[(2,3,4,5,6-pentadeuteriophenyl)sulfamoyl]phenyl]prop-2-enoic acid |
| InChIKey | ALGZPROJSRYPIG-HMUIAXRESA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])NS(=O)(=O)C2=CC=CC(=C2)/C=C/C(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)