Products 794510-29-5
CAS 794510-29-5 appears in our catalog under these names: Epalrestat Impurity 13, Epalrestat Impurity 8. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (CAS 794510-29-5) is a chemical compound with the molecular formula C15H13NO4S and a molecular weight of 303.3 g/mol. IUPAC name: 2-[(5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid. InChIKey: VHARQOHGADYUIA-NFZZJPOKSA-N.
| Molecular formula | C15H13NO4S |
|---|---|
| Molecular weight | 303.3 g/mol |
| IUPAC name | 2-[(5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| InChIKey | VHARQOHGADYUIA-NFZZJPOKSA-N |
| SMILES | C/C(=C\C1=CC=CC=C1)/C=C\2/C(=O)N(C(=O)S2)CC(=O)O |
Computed by PubChem (NCBI)