Products 1321974-20-2
CAS 1321974-20-2 is the registry number for 2-[2-(2-Aminophenyl)vinyl]-5,7-dimethylquinolin-8-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[(E)-2-(2-aminophenyl)ethenyl]-5,7-dimethylquinolin-8-ol (CAS 1321974-20-2) is a chemical compound with the molecular formula C19H18N2O and a molecular weight of 290.4 g/mol. IUPAC name: 2-[(E)-2-(2-aminophenyl)ethenyl]-5,7-dimethylquinolin-8-ol. InChIKey: IAUYNRXPNUEEHD-BQYQJAHWSA-N.
| Molecular formula | C19H18N2O |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | 2-[(E)-2-(2-aminophenyl)ethenyl]-5,7-dimethylquinolin-8-ol |
| InChIKey | IAUYNRXPNUEEHD-BQYQJAHWSA-N |
| SMILES | CC1=CC(=C(C2=C1C=CC(=N2)/C=C/C3=CC=CC=C3N)O)C |
Computed by PubChem (NCBI)