CAS 944267-48-5 is the registry number for Demiditraz Impurity 2. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(1-benzylimidazol-2-yl)-(2,3-dimethylphenyl)methanone (CAS 944267-48-5) is a chemical compound with the molecular formula C19H18N2O and a molecular weight of 290.4 g/mol. IUPAC name: (1-benzylimidazol-2-yl)-(2,3-dimethylphenyl)methanone. InChIKey: FAZICGPKLJLBRJ-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | (1-benzylimidazol-2-yl)-(2,3-dimethylphenyl)methanone |
| InChIKey | FAZICGPKLJLBRJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(=O)C2=NC=CN2CC3=CC=CC=C3)C |
Computed by PubChem (NCBI)