CAS 425628-39-3 is the registry number for 3-Mesityl-1-phenyl-1H-pyrazole-4-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-phenyl-3-(2,4,6-trimethylphenyl)pyrazole-4-carbaldehyde (CAS 425628-39-3) is a chemical compound with the molecular formula C19H18N2O and a molecular weight of 290.4 g/mol. IUPAC name: 1-phenyl-3-(2,4,6-trimethylphenyl)pyrazole-4-carbaldehyde. InChIKey: UZVKOZOSARLISJ-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | 1-phenyl-3-(2,4,6-trimethylphenyl)pyrazole-4-carbaldehyde |
| InChIKey | UZVKOZOSARLISJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C2=NN(C=C2C=O)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)