Products 1322605-19-5

CAS 1322605-19-5 is the registry number for Methyl 2-(5-chloro-1H-1,2,4-triazol-3-yl)benzoate hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 2-(5-chloro-1H-1,2,4-triazol-3-yl)benzoate;hydrochloride (CAS 1322605-19-5) is a chemical compound with the molecular formula C10H9Cl2N3O2 and a molecular weight of 274.10 g/mol. IUPAC name: methyl 2-(5-chloro-1H-1,2,4-triazol-3-yl)benzoate;hydrochloride. InChIKey: RBJMEEVBEGIPDV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9Cl2N3O2
Molecular weight274.10 g/mol
IUPAC namemethyl 2-(5-chloro-1H-1,2,4-triazol-3-yl)benzoate;hydrochloride
InChIKeyRBJMEEVBEGIPDV-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=CC=C1C2=NNC(=N2)Cl.Cl

Computed by PubChem (NCBI)