CAS 1322605-19-5 is the registry number for Methyl 2-(5-chloro-1H-1,2,4-triazol-3-yl)benzoate hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(5-chloro-1H-1,2,4-triazol-3-yl)benzoate;hydrochloride (CAS 1322605-19-5) is a chemical compound with the molecular formula C10H9Cl2N3O2 and a molecular weight of 274.10 g/mol. IUPAC name: methyl 2-(5-chloro-1H-1,2,4-triazol-3-yl)benzoate;hydrochloride. InChIKey: RBJMEEVBEGIPDV-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2N3O2 |
|---|---|
| Molecular weight | 274.10 g/mol |
| IUPAC name | methyl 2-(5-chloro-1H-1,2,4-triazol-3-yl)benzoate;hydrochloride |
| InChIKey | RBJMEEVBEGIPDV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC=C1C2=NNC(=N2)Cl.Cl |
Computed by PubChem (NCBI)