CAS 1909317-47-0 is the registry number for Methyl 5-chloro-2-(1H-1,2,4-triazol-1-yl)benzoate hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Methyl 5-chloro-2-(1,2,4-triazol-1-yl)benzoate;hydrochloride (CAS 1909317-47-0) is a chemical compound with the molecular formula C10H9Cl2N3O2 and a molecular weight of 274.10 g/mol. IUPAC name: methyl 5-chloro-2-(1,2,4-triazol-1-yl)benzoate;hydrochloride. InChIKey: BECMCMBYFHUHQT-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2N3O2 |
|---|---|
| Molecular weight | 274.10 g/mol |
| IUPAC name | methyl 5-chloro-2-(1,2,4-triazol-1-yl)benzoate;hydrochloride |
| InChIKey | BECMCMBYFHUHQT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Cl)N2C=NC=N2.Cl |
Computed by PubChem (NCBI)