CAS 79572-01-3 is the registry number for 2,8-Dichloro-6,7-dimethoxyquinazolin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,8-dichloro-6,7-dimethoxyquinazolin-4-amine (CAS 79572-01-3) is a chemical compound with the molecular formula C10H9Cl2N3O2 and a molecular weight of 274.10 g/mol. IUPAC name: 2,8-dichloro-6,7-dimethoxyquinazolin-4-amine. InChIKey: JKLVPCJNSSNVIS-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2N3O2 |
|---|---|
| Molecular weight | 274.10 g/mol |
| IUPAC name | 2,8-dichloro-6,7-dimethoxyquinazolin-4-amine |
| InChIKey | JKLVPCJNSSNVIS-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C(=C1)C(=NC(=N2)Cl)N)Cl)OC |
Computed by PubChem (NCBI)