CAS 13229-03-3 is the registry number for 2-Hydrazinyl-5-phenyl-1,3,4-thiadiazole, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(5-phenyl-1,3,4-thiadiazol-2-yl)hydrazine (CAS 13229-03-3) is a chemical compound with the molecular formula C8H8N4S and a molecular weight of 192.24 g/mol. IUPAC name: (5-phenyl-1,3,4-thiadiazol-2-yl)hydrazine. InChIKey: COYPLZXSHTZYFQ-UHFFFAOYSA-N.
| Molecular formula | C8H8N4S |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | (5-phenyl-1,3,4-thiadiazol-2-yl)hydrazine |
| InChIKey | COYPLZXSHTZYFQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(S2)NN |
Computed by PubChem (NCBI)