CAS 13230-08-5 is the registry number for 4-Nitro-1-propyl-1H-imidazole 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-nitro-1-propylimidazole (CAS 13230-08-5) is a chemical compound with the molecular formula C6H9N3O2 and a molecular weight of 155.15 g/mol. IUPAC name: 4-nitro-1-propylimidazole. InChIKey: YYYLBBHRZVIYQC-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O2 |
|---|---|
| Molecular weight | 155.15 g/mol |
| IUPAC name | 4-nitro-1-propylimidazole |
| InChIKey | YYYLBBHRZVIYQC-UHFFFAOYSA-N |
| SMILES | CCCN1C=C(N=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)